C23H26N2O — CID 157184738
1-[3-[[3-(2-methylprop-2-enyl)phenyl]methyl]-5-phenylimidazol-4-yl]propan-2-ol (PubChem CID 157184738) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[3-[[3-(2-methylprop-2-enyl)phenyl]methyl]-5-phenylimidazol-4-yl]propan-2-ol.
| Compound Name | 1-[3-[[3-(2-methylprop-2-enyl)phenyl]methyl]-5-phenylimidazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 157184738 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[3-[[3-(2-methylprop-2-enyl)phenyl]methyl]-5-phenylimidazol-4-yl]propan-2-ol |
| SMILES | C=C(C)Cc1cccc(Cn2cnc(-c3ccccc3)c2CC(C)O)c1 |
| InChI | InChI=1S/C23H26N2O/c1-17(2)12-19-8-7-9-20(14-19)15-25-16-24-23(22(25)13-18(3)26)21-10-5-4-6-11-21/h4-11,14,16,18,26H,1,12-13,15H2,2-3H3 |
| InChIKey | NFULNFINLGOLJM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|