C20H20N2 — CID 135065600
1-methyl-4-(2-methylprop-2-enyl)-3,5-diphenylpyrazole (PubChem CID 135065600) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-methyl-4-(2-methylprop-2-enyl)-3,5-diphenylpyrazole.
| Compound Name | 1-methyl-4-(2-methylprop-2-enyl)-3,5-diphenylpyrazole |
|---|---|
| PubChem CID | 135065600 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-methyl-4-(2-methylprop-2-enyl)-3,5-diphenylpyrazole |
| SMILES | C=C(C)Cc1c(-c2ccccc2)nn(C)c1-c1ccccc1 |
| InChI | InChI=1S/C20H20N2/c1-15(2)14-18-19(16-10-6-4-7-11-16)21-22(3)20(18)17-12-8-5-9-13-17/h4-13H,1,14H2,2-3H3 |
| InChIKey | XOJJSJLJNADETQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|