C27H25NO — CID 102230931
3,5-bis(2-methylprop-2-enyl)-2,6-diphenylfuro[2,3-b]pyridine (PubChem CID 102230931) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is 3,5-bis(2-methylprop-2-enyl)-2,6-diphenylfuro[2,3-b]pyridine.
| Compound Name | 3,5-bis(2-methylprop-2-enyl)-2,6-diphenylfuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 102230931 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3,5-bis(2-methylprop-2-enyl)-2,6-diphenylfuro[2,3-b]pyridine |
| SMILES | C=C(C)Cc1cc2c(CC(=C)C)c(-c3ccccc3)oc2nc1-c1ccccc1 |
| InChI | InChI=1S/C27H25NO/c1-18(2)15-22-17-24-23(16-19(3)4)26(21-13-9-6-10-14-21)29-27(24)28-25(22)20-11-7-5-8-12-20/h5-14,17H,1,3,15-16H2,2,4H3 |
| InChIKey | DDCOQNUERIHREO-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|