C26H23NO2 — CID 102230929
2-(4-methoxyphenyl)-6-phenyl-3,5-bis(prop-2-enyl)furo[2,3-b]pyridine (PubChem CID 102230929) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-phenyl-3,5-bis(prop-2-enyl)furo[2,3-b]pyridine.
| Compound Name | 2-(4-methoxyphenyl)-6-phenyl-3,5-bis(prop-2-enyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 102230929 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-phenyl-3,5-bis(prop-2-enyl)furo[2,3-b]pyridine |
| SMILES | C=CCc1cc2c(CC=C)c(-c3ccc(OC)cc3)oc2nc1-c1ccccc1 |
| InChI | InChI=1S/C26H23NO2/c1-4-9-20-17-23-22(10-5-2)25(19-13-15-21(28-3)16-14-19)29-26(23)27-24(20)18-11-7-6-8-12-18/h4-8,11-17H,1-2,9-10H2,3H3 |
| InChIKey | YYRRNKNGNKLVLZ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|