C36H30N4O2S — CID 153415721
2-[5-methoxy-2-[3-[9-(4-methyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-4-phenylpyrazol-3-yl]ethanethiol (PubChem CID 153415721) has the molecular formula C36H30N4O2S and a molecular weight of 582.73 g/mol. Its IUPAC name is 2-[5-methoxy-2-[3-[9-(4-methyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-4-phenylpyrazol-3-yl]ethanethiol.
| Compound Name | 2-[5-methoxy-2-[3-[9-(4-methyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-4-phenylpyrazol-3-yl]ethanethiol |
|---|---|
| PubChem CID | 153415721 |
| Molecular Formula | C36H30N4O2S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 2-[5-methoxy-2-[3-[9-(4-methyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-4-phenylpyrazol-3-yl]ethanethiol |
| SMILES | COc1nn(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C)ccn5)c4c3)c2)c(CCS)c1-c1ccccc1 |
| InChI | InChI=1S/C36H30N4O2S/c1-24-17-19-37-34(21-24)39-31-14-7-6-13-29(31)30-16-15-28(23-33(30)39)42-27-12-8-11-26(22-27)40-32(18-20-43)35(36(38-40)41-2)25-9-4-3-5-10-25/h3-17,19,21-23,43H,18,20H2,1-2H3 |
| InChIKey | HVHGSKICPMQNEV-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|