C42H42N4O — CID 153441092
2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-methyl-2-pyridinyl)-6-pentylcarbazole (PubChem CID 153441092) has the molecular formula C42H42N4O and a molecular weight of 618.83 g/mol. Its IUPAC name is 2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-methyl-2-pyridinyl)-6-pentylcarbazole.
| Compound Name | 2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-methyl-2-pyridinyl)-6-pentylcarbazole |
|---|---|
| PubChem CID | 153441092 |
| Molecular Formula | C42H42N4O |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | 2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-methyl-2-pyridinyl)-6-pentylcarbazole |
| SMILES | CCCCCc1ccc2c(c1)c1ccc(Oc3cccc(-n4nc(CC)c(-c5ccccc5)c4CC)c3)cc1n2-c1cc(C)ccn1 |
| InChI | InChI=1S/C42H42N4O/c1-5-8-10-14-30-19-22-39-36(26-30)35-21-20-34(28-40(35)45(39)41-25-29(4)23-24-43-41)47-33-18-13-17-32(27-33)46-38(7-3)42(37(6-2)44-46)31-15-11-9-12-16-31/h9,11-13,15-28H,5-8,10,14H2,1-4H3 |
| InChIKey | HCYBPSRGODESCF-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|