C51H60N4O — CID 153442107
2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5-methylhexyl)carbazole (PubChem CID 153442107) has the molecular formula C51H60N4O and a molecular weight of 745.07 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5-methylhexyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5-methylhexyl)carbazole |
|---|---|
| PubChem CID | 153442107 |
| Molecular Formula | C51H60N4O |
| Molecular Weight | 745.07 g/mol |
| Exact Mass | 744.48 |
| IUPAC Name | 2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5-methylhexyl)carbazole |
| SMILES | CCc1nn(-c2cc(Oc3ccc4c5cc(CCCCC(C)C)ccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)cc(C(C)(C)C)c2)c(CC)c1-c1ccccc1 |
| InChI | InChI=1S/C51H60N4O/c1-11-44-49(36-20-14-13-15-21-36)45(12-2)55(53-44)39-29-38(51(8,9)10)30-41(32-39)56-40-23-24-42-43-28-35(19-17-16-18-34(3)4)22-25-46(43)54(47(42)33-40)48-31-37(26-27-52-48)50(5,6)7/h13-15,20-34H,11-12,16-19H2,1-10H3 |
| InChIKey | VMHKQGYASJYFDY-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.07 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|