C52H62N4O — CID 153442270
2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)carbazole (PubChem CID 153442270) has the molecular formula C52H62N4O and a molecular weight of 759.09 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)carbazole |
|---|---|
| PubChem CID | 153442270 |
| Molecular Formula | C52H62N4O |
| Molecular Weight | 759.09 g/mol |
| Exact Mass | 758.49 |
| IUPAC Name | 2-[3-tert-butyl-5-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)carbazole |
| SMILES | CCc1nn(-c2cc(Oc3ccc4c5cc(CCCCC(C)(C)C)ccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)cc(C(C)(C)C)c2)c(CC)c1-c1ccccc1 |
| InChI | InChI=1S/C52H62N4O/c1-12-44-49(36-20-15-14-16-21-36)45(13-2)56(54-44)39-30-38(52(9,10)11)31-41(33-39)57-40-23-24-42-43-29-35(19-17-18-27-50(3,4)5)22-25-46(43)55(47(42)34-40)48-32-37(26-28-53-48)51(6,7)8/h14-16,20-26,28-34H,12-13,17-19,27H2,1-11H3 |
| InChIKey | CLFYYLUFSXUPMS-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.09 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|