C45H46N4OPt — CID 153441453
2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-(5,5-dimethylhexyl)-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153441453) has the molecular formula C45H46N4OPt and a molecular weight of 853.97 g/mol. Its IUPAC name is 2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-(5,5-dimethylhexyl)-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-(5,5-dimethylhexyl)-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153441453 |
| Molecular Formula | C45H46N4OPt |
| Molecular Weight | 853.97 g/mol |
| Exact Mass | 853.33 |
| IUPAC Name | 2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-(5,5-dimethylhexyl)-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCc1nn(-c2[c-]c(Oc3[c-]c4c(cc3)c3cc(CCCCC(C)(C)C)ccc3n4-c3cc(C)ccn3)ccc2)c(CC)c1-c1ccccc1.[Pt+2] |
| InChI | InChI=1S/C45H46N4O.Pt/c1-7-39-44(33-16-10-9-11-17-33)40(8-2)49(47-39)34-18-14-19-35(29-34)50-36-21-22-37-38-28-32(15-12-13-25-45(4,5)6)20-23-41(38)48(42(37)30-36)43-27-31(3)24-26-46-43;/h9-11,14,16-24,26-28H,7-8,12-13,15,25H2,1-6H3;/q-2;+2 |
| InChIKey | QKAOCHUDOCNDLV-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.97 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|