C42H40N4OPt — CID 153440926
9-(4-deuterio-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153440926) has the molecular formula C42H40N4OPt and a molecular weight of 812.89 g/mol. Its IUPAC name is 9-(4-deuterio-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-deuterio-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153440926 |
| Molecular Formula | C42H40N4OPt |
| Molecular Weight | 812.89 g/mol |
| Exact Mass | 812.29 |
| IUPAC Name | 9-(4-deuterio-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
| SMILES | [2H]c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5nc(C)c(-c6ccccc6)c5C)ccc4)ccc3c3cc(CCCCC(C)(C)C)ccc32)c1.[Pt+2] |
| InChI | InChI=1S/C42H40N4O.Pt/c1-29-41(32-15-7-6-8-16-32)30(2)46(44-29)33-17-13-18-34(27-33)47-35-21-22-36-37-26-31(14-9-11-24-42(3,4)5)20-23-38(37)45(39(36)28-35)40-19-10-12-25-43-40;/h6-8,10,12-13,15-23,25-26H,9,11,14,24H2,1-5H3;/q-2;+2/i10D; |
| InChIKey | JAWRDHWUGAVOEE-GIZWGYPNSA-N |
| XLogP | 10.80 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.89 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|