C45H46N4OPt — CID 153442065
2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(3-methylbutyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153442065) has the molecular formula C45H46N4OPt and a molecular weight of 853.97 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(3-methylbutyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(3-methylbutyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153442065 |
| Molecular Formula | C45H46N4OPt |
| Molecular Weight | 853.97 g/mol |
| Exact Mass | 853.33 |
| IUPAC Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(3-methylbutyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCCCCCc1ccc2c(c1)c1ccc(Oc3[c-]c(-n4nc(C)c(-c5ccccc5)c4C)ccc3)[c-]c1n2-c1cc(CCC(C)C)ccn1.[Pt+2] |
| InChI | InChI=1S/C45H46N4O.Pt/c1-6-7-8-10-14-34-21-24-42-41(27-34)40-23-22-39(30-43(40)48(42)44-28-35(25-26-46-44)20-19-31(2)3)50-38-18-13-17-37(29-38)49-33(5)45(32(4)47-49)36-15-11-9-12-16-36;/h9,11-13,15-18,21-28,31H,6-8,10,14,19-20H2,1-5H3;/q-2;+2 |
| InChIKey | BQGLADYTJPSPRC-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.97 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|