C44H44N4OPt — CID 153442359
2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(2-methylpropyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153442359) has the molecular formula C44H44N4OPt and a molecular weight of 839.94 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(2-methylpropyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(2-methylpropyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153442359 |
| Molecular Formula | C44H44N4OPt |
| Molecular Weight | 839.94 g/mol |
| Exact Mass | 839.32 |
| IUPAC Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-6-hexyl-9-[4-(2-methylpropyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCCCCCc1ccc2c(c1)c1ccc(Oc3[c-]c(-n4nc(C)c(-c5ccccc5)c4C)ccc3)[c-]c1n2-c1cc(CC(C)C)ccn1.[Pt+2] |
| InChI | InChI=1S/C44H44N4O.Pt/c1-6-7-8-10-14-33-19-22-41-40(26-33)39-21-20-38(29-42(39)47(41)43-27-34(23-24-45-43)25-30(2)3)49-37-18-13-17-36(28-37)48-32(5)44(31(4)46-48)35-15-11-9-12-16-35;/h9,11-13,15-24,26-27,30H,6-8,10,14,25H2,1-5H3;/q-2;+2 |
| InChIKey | XMAUFMRYKYMIOS-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.94 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|