C44H44N4OPt — CID 153441725
6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-9-(4-ethyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153441725) has the molecular formula C44H44N4OPt and a molecular weight of 839.94 g/mol. Its IUPAC name is 6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-9-(4-ethyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-9-(4-ethyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153441725 |
| Molecular Formula | C44H44N4OPt |
| Molecular Weight | 839.94 g/mol |
| Exact Mass | 839.32 |
| IUPAC Name | 6-(5,5-dimethylhexyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-2-id-1-yl]oxy-9-(4-ethyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCc1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5nc(C)c(-c6ccccc6)c5C)ccc4)ccc3c3cc(CCCCC(C)(C)C)ccc32)c1.[Pt+2] |
| InChI | InChI=1S/C44H44N4O.Pt/c1-7-32-23-25-45-42(27-32)47-40-22-19-33(14-11-12-24-44(4,5)6)26-39(40)38-21-20-37(29-41(38)47)49-36-18-13-17-35(28-36)48-31(3)43(30(2)46-48)34-15-9-8-10-16-34;/h8-10,13,15-23,25-27H,7,11-12,14,24H2,1-6H3;/q-2;+2 |
| InChIKey | ZJEMKMIBLFHODY-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.94 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|