C46H48N4OPt — CID 153442283
2-[3-(3,3-dimethylbutyl)-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-6-pentyl-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153442283) has the molecular formula C46H48N4OPt and a molecular weight of 867.99 g/mol. Its IUPAC name is 2-[3-(3,3-dimethylbutyl)-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-6-pentyl-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-(3,3-dimethylbutyl)-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-6-pentyl-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153442283 |
| Molecular Formula | C46H48N4OPt |
| Molecular Weight | 867.99 g/mol |
| Exact Mass | 867.35 |
| IUPAC Name | 2-[3-(3,3-dimethylbutyl)-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-6-pentyl-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCCCCc1ccc2c(c1)c1ccc(Oc3[c-]c(-n4nc(C)c(-c5ccccc5)c4C)cc(CCC(C)(C)C)c3)[c-]c1n2-c1cc(C)ccn1.[Pt+2] |
| InChI | InChI=1S/C46H48N4O.Pt/c1-8-9-11-14-34-17-20-42-41(28-34)40-19-18-38(30-43(40)49(42)44-25-31(2)22-24-47-44)51-39-27-35(21-23-46(5,6)7)26-37(29-39)50-33(4)45(32(3)48-50)36-15-12-10-13-16-36;/h10,12-13,15-20,22,24-28H,8-9,11,14,21,23H2,1-7H3;/q-2;+2 |
| InChIKey | QAWXVURZZWBNAM-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.99 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|