C40H36N4OPt — CID 153441767
6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylbenzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153441767) has the molecular formula C40H36N4OPt and a molecular weight of 784.84 g/mol. Its IUPAC name is 6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylbenzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylbenzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153441767 |
| Molecular Formula | C40H36N4OPt |
| Molecular Weight | 784.84 g/mol |
| Exact Mass | 784.26 |
| IUPAC Name | 6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylbenzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | [2H]c1ccc2c(c1)c1ccc(Oc3[c-]c(-n4nc(C)c(-c5ccccc5)c4C)cc(CCCCC)c3)[c-]c1n2-c1cc(C)ccn1.[Pt+2] |
| InChI | InChI=1S/C40H36N4O.Pt/c1-5-6-8-13-30-23-32(44-29(4)40(28(3)42-44)31-14-9-7-10-15-31)25-34(24-30)45-33-18-19-36-35-16-11-12-17-37(35)43(38(36)26-33)39-22-27(2)20-21-41-39;/h7,9-12,14-24H,5-6,8,13H2,1-4H3;/q-2;+2/i11D; |
| InChIKey | RZRFMFYLNBVLFI-DBHJEENASA-N |
| XLogP | 10.08 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.84 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|