C47H50N4OPt — CID 153441464
2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-(3-methylbutyl)benzene-2-id-1-yl]oxy-6-heptan-2-yl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153441464) has the molecular formula C47H50N4OPt and a molecular weight of 882.02 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-(3-methylbutyl)benzene-2-id-1-yl]oxy-6-heptan-2-yl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-(3-methylbutyl)benzene-2-id-1-yl]oxy-6-heptan-2-yl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153441464 |
| Molecular Formula | C47H50N4OPt |
| Molecular Weight | 882.02 g/mol |
| Exact Mass | 881.36 |
| IUPAC Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-(3-methylbutyl)benzene-2-id-1-yl]oxy-6-heptan-2-yl-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCCCCC(C)c1ccc2c(c1)c1ccc(Oc3[c-]c(-n4nc(C)c(-c5ccccc5)c4C)cc(CCC(C)C)c3)[c-]c1n2-c1cc(C)ccn1.[Pt+2] |
| InChI | InChI=1S/C47H50N4O.Pt/c1-8-9-11-14-33(5)38-19-22-44-43(28-38)42-21-20-40(30-45(42)50(44)46-25-32(4)23-24-48-46)52-41-27-36(18-17-31(2)3)26-39(29-41)51-35(7)47(34(6)49-51)37-15-12-10-13-16-37;/h10,12-13,15-16,19-28,31,33H,8-9,11,14,17-18H2,1-7H3;/q-2;+2 |
| InChIKey | RYVLNXSYULCFOX-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.02 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|