C49H54N4OPt — CID 153441583
2-[3-tert-butyl-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-6-heptan-2-yl-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153441583) has the molecular formula C49H54N4OPt and a molecular weight of 910.08 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-6-heptan-2-yl-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-tert-butyl-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-6-heptan-2-yl-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153441583 |
| Molecular Formula | C49H54N4OPt |
| Molecular Weight | 910.08 g/mol |
| Exact Mass | 909.39 |
| IUPAC Name | 2-[3-tert-butyl-5-(3,5-dimethyl-4-phenylpyrazol-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-6-heptan-2-yl-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCCCCC(C)c1ccc2c(c1)c1ccc(Oc3[c-]c(-n4nc(C)c(-c5ccccc5)c4C)cc(C(C)(C)C)c3)[c-]c1n2-c1cc(C(C)(C)C)ccn1.[Pt+2] |
| InChI | InChI=1S/C49H54N4O.Pt/c1-11-12-14-17-32(2)36-20-23-44-43(26-36)42-22-21-40(31-45(42)52(44)46-29-37(24-25-50-46)48(5,6)7)54-41-28-38(49(8,9)10)27-39(30-41)53-34(4)47(33(3)51-53)35-18-15-13-16-19-35;/h13,15-16,18-29,32H,11-12,14,17H2,1-10H3;/q-2;+2 |
| InChIKey | ZTTFZQFEBKMKJY-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.08 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|