C47H52N4O — CID 153441678
9-(4-tert-butyl-2-pyridinyl)-2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-6-(5-methylhexyl)carbazole (PubChem CID 153441678) has the molecular formula C47H52N4O and a molecular weight of 688.96 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-6-(5-methylhexyl)carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-6-(5-methylhexyl)carbazole |
|---|---|
| PubChem CID | 153441678 |
| Molecular Formula | C47H52N4O |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.41 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3,5-diethyl-4-phenylpyrazol-1-yl)phenoxy]-6-(5-methylhexyl)carbazole |
| SMILES | CCc1nn(-c2cccc(Oc3ccc4c5cc(CCCCC(C)C)ccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c(CC)c1-c1ccccc1 |
| InChI | InChI=1S/C47H52N4O/c1-8-41-46(34-18-11-10-12-19-34)42(9-2)51(49-41)36-20-15-21-37(30-36)52-38-23-24-39-40-28-33(17-14-13-16-32(3)4)22-25-43(40)50(44(39)31-38)45-29-35(26-27-48-45)47(5,6)7/h10-12,15,18-32H,8-9,13-14,16-17H2,1-7H3 |
| InChIKey | XWVZLOFJFMXTAK-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|