C45H48N4O — CID 153442032
2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-propan-2-ylphenoxy]-6-(5-methylhexyl)-9-(4-methyl-2-pyridinyl)carbazole (PubChem CID 153442032) has the molecular formula C45H48N4O and a molecular weight of 660.91 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-propan-2-ylphenoxy]-6-(5-methylhexyl)-9-(4-methyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-propan-2-ylphenoxy]-6-(5-methylhexyl)-9-(4-methyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153442032 |
| Molecular Formula | C45H48N4O |
| Molecular Weight | 660.91 g/mol |
| Exact Mass | 660.38 |
| IUPAC Name | 2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-propan-2-ylphenoxy]-6-(5-methylhexyl)-9-(4-methyl-2-pyridinyl)carbazole |
| SMILES | Cc1ccnc(-n2c3ccc(CCCCC(C)C)cc3c3ccc(Oc4cc(C(C)C)cc(-n5nc(C)c(-c6ccccc6)c5C)c4)cc32)c1 |
| InChI | InChI=1S/C45H48N4O/c1-29(2)13-11-12-14-34-17-20-42-41(24-34)40-19-18-38(28-43(40)48(42)44-23-31(5)21-22-46-44)50-39-26-36(30(3)4)25-37(27-39)49-33(7)45(32(6)47-49)35-15-9-8-10-16-35/h8-10,15-30H,11-14H2,1-7H3 |
| InChIKey | ZAXALLMOSHMEDM-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.91 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|