C44H46N4O — CID 153441094
9-(4-butyl-2-pyridinyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-6-hexylcarbazole (PubChem CID 153441094) has the molecular formula C44H46N4O and a molecular weight of 646.88 g/mol. Its IUPAC name is 9-(4-butyl-2-pyridinyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-6-hexylcarbazole.
| Compound Name | 9-(4-butyl-2-pyridinyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-6-hexylcarbazole |
|---|---|
| PubChem CID | 153441094 |
| Molecular Formula | C44H46N4O |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.37 |
| IUPAC Name | 9-(4-butyl-2-pyridinyl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-6-hexylcarbazole |
| SMILES | CCCCCCc1ccc2c(c1)c1ccc(Oc3cccc(-n4nc(C)c(-c5ccccc5)c4C)c3)cc1n2-c1cc(CCCC)ccn1 |
| InChI | InChI=1S/C44H46N4O/c1-5-7-9-11-16-33-21-24-41-40(27-33)39-23-22-38(30-42(39)47(41)43-28-34(15-8-6-2)25-26-45-43)49-37-20-14-19-36(29-37)48-32(4)44(31(3)46-48)35-17-12-10-13-18-35/h10,12-14,17-30H,5-9,11,15-16H2,1-4H3 |
| InChIKey | SLMQIQPORYXQKA-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|