C39H36N4O — CID 153441140
6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-pentyl-2-pyridinyl)carbazole (PubChem CID 153441140) has the molecular formula C39H36N4O and a molecular weight of 577.75 g/mol. Its IUPAC name is 6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-pentyl-2-pyridinyl)carbazole.
| Compound Name | 6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-pentyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153441140 |
| Molecular Formula | C39H36N4O |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 6-deuterio-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)phenoxy]-9-(4-pentyl-2-pyridinyl)carbazole |
| SMILES | [2H]c1ccc2c(c1)c1ccc(Oc3cccc(-n4nc(C)c(-c5ccccc5)c4C)c3)cc1n2-c1cc(CCCCC)ccn1 |
| InChI | InChI=1S/C39H36N4O/c1-4-5-7-13-29-22-23-40-38(24-29)42-36-19-11-10-18-34(36)35-21-20-33(26-37(35)42)44-32-17-12-16-31(25-32)43-28(3)39(27(2)41-43)30-14-8-6-9-15-30/h6,8-12,14-26H,4-5,7,13H2,1-3H3/i10D |
| InChIKey | RHKMDYZSXGFACC-MMIHMFRQSA-N |
| XLogP | 10.17 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|