C50H58N4O — CID 153441036
9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(4-phenyl-3,5-dipropylpyrazol-1-yl)phenoxy]carbazole (PubChem CID 153441036) has the molecular formula C50H58N4O and a molecular weight of 731.04 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(4-phenyl-3,5-dipropylpyrazol-1-yl)phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(4-phenyl-3,5-dipropylpyrazol-1-yl)phenoxy]carbazole |
|---|---|
| PubChem CID | 153441036 |
| Molecular Formula | C50H58N4O |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.46 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-6-(5,5-dimethylhexyl)-2-[3-(4-phenyl-3,5-dipropylpyrazol-1-yl)phenoxy]carbazole |
| SMILES | CCCc1nn(-c2cccc(Oc3ccc4c5cc(CCCCC(C)(C)C)ccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c(CCC)c1-c1ccccc1 |
| InChI | InChI=1S/C50H58N4O/c1-9-17-43-48(36-20-12-11-13-21-36)45(18-10-2)54(52-43)38-22-16-23-39(33-38)55-40-25-26-41-42-31-35(19-14-15-29-49(3,4)5)24-27-44(42)53(46(41)34-40)47-32-37(28-30-51-47)50(6,7)8/h11-13,16,20-28,30-34H,9-10,14-15,17-19,29H2,1-8H3 |
| InChIKey | WTLLOOXHHWVNIV-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|