C39H40N4O — CID 153416015
2-[3-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole (PubChem CID 153416015) has the molecular formula C39H40N4O and a molecular weight of 580.78 g/mol. Its IUPAC name is 2-[3-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153416015 |
| Molecular Formula | C39H40N4O |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 2-[3-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole |
| SMILES | CC1=CCC[C@H](C)C1c1c(C)nn(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)C)ccn5)c4c3)c2)c1C |
| InChI | InChI=1S/C39H40N4O/c1-24(2)29-19-20-40-37(21-29)42-35-16-8-7-15-33(35)34-18-17-32(23-36(34)42)44-31-14-10-13-30(22-31)43-28(6)39(27(5)41-43)38-25(3)11-9-12-26(38)4/h7-8,10-11,13-24,26,38H,9,12H2,1-6H3/t26-,38?/m0/s1 |
| InChIKey | BWLCOCGREVGCKN-MQCYKSAASA-N |
| XLogP | 10.36 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|