C44H50N4O — CID 153416075
2-[3-tert-butyl-5-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole (PubChem CID 153416075) has the molecular formula C44H50N4O and a molecular weight of 650.91 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153416075 |
| Molecular Formula | C44H50N4O |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | 2-[3-tert-butyl-5-[4-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole |
| SMILES | CCCCc1ccnc(-n2c3ccccc3c3ccc(Oc4cc(-n5nc(C)c(C6C(C)=CCC[C@@H]6C)c5C)cc(C(C)(C)C)c4)cc32)c1 |
| InChI | InChI=1S/C44H50N4O/c1-9-10-16-32-21-22-45-41(23-32)47-39-18-12-11-17-37(39)38-20-19-35(27-40(38)47)49-36-25-33(44(6,7)8)24-34(26-36)48-31(5)43(30(4)46-48)42-28(2)14-13-15-29(42)3/h11-12,14,17-27,29,42H,9-10,13,15-16H2,1-8H3/t29-,42?/m0/s1 |
| InChIKey | FHOHFXVIXVUCDH-OGIPZDPZSA-N |
| XLogP | 11.87 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|