C40H36F6N4O — CID 161023846
2-[3-[4-[(1R,6S)-2,6-bis(trifluoromethyl)cyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole (PubChem CID 161023846) has the molecular formula C40H36F6N4O and a molecular weight of 702.74 g/mol. Its IUPAC name is 2-[3-[4-[(1R,6S)-2,6-bis(trifluoromethyl)cyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[4-[(1R,6S)-2,6-bis(trifluoromethyl)cyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 161023846 |
| Molecular Formula | C40H36F6N4O |
| Molecular Weight | 702.74 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | 2-[3-[4-[(1R,6S)-2,6-bis(trifluoromethyl)cyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]phenoxy]-9-(4-butyl-2-pyridinyl)carbazole |
| SMILES | CCCCc1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5nc(C)c([C@@H]6C(C(F)(F)F)=CCC[C@@H]6C(F)(F)F)c5C)c4)cc32)c1 |
| InChI | InChI=1S/C40H36F6N4O/c1-4-5-10-26-19-20-47-36(21-26)49-34-16-7-6-13-30(34)31-18-17-29(23-35(31)49)51-28-12-8-11-27(22-28)50-25(3)37(24(2)48-50)38-32(39(41,42)43)14-9-15-33(38)40(44,45)46/h6-8,11-14,16-23,33,38H,4-5,9-10,15H2,1-3H3/t33-,38+/m0/s1 |
| InChIKey | CYVPDCFZCGLCQK-MLZZNZMKSA-N |
| XLogP | 11.66 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.74 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|