C47H56N4O — CID 153416223
2-[3-tert-butyl-5-[3,5-dipropyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole (PubChem CID 153416223) has the molecular formula C47H56N4O and a molecular weight of 692.99 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[3,5-dipropyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-[3,5-dipropyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153416223 |
| Molecular Formula | C47H56N4O |
| Molecular Weight | 692.99 g/mol |
| Exact Mass | 692.45 |
| IUPAC Name | 2-[3-tert-butyl-5-[3,5-dipropyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole |
| SMILES | CCCc1nn(-c2cc(Oc3ccc4c5ccccc5n(-c5cc(CC)ccn5)c4c3)cc(C(C)(C)C)c2)c(CCC)c1C1C(C)=C[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C47H56N4O/c1-10-15-40-46(45-31(5)23-30(4)24-32(45)6)42(16-11-2)51(49-40)35-26-34(47(7,8)9)27-37(28-35)52-36-19-20-39-38-17-13-14-18-41(38)50(43(39)29-36)44-25-33(12-3)21-22-48-44/h13-14,17-23,25-30,32,45H,10-12,15-16,24H2,1-9H3/t30-,32-,45?/m0/s1 |
| InChIKey | RPNOAPWHBRFMIV-KGYYTDRPSA-N |
| XLogP | 12.63 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.99 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|