C45H52N4O — CID 153417035
2-[3-[3,5-dibutyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]-5-methylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole (PubChem CID 153417035) has the molecular formula C45H52N4O and a molecular weight of 664.94 g/mol. Its IUPAC name is 2-[3-[3,5-dibutyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]-5-methylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[3,5-dibutyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]-5-methylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153417035 |
| Molecular Formula | C45H52N4O |
| Molecular Weight | 664.94 g/mol |
| Exact Mass | 664.41 |
| IUPAC Name | 2-[3-[3,5-dibutyl-4-[(4R,6S)-2,4,6-trimethylcyclohex-2-en-1-yl]pyrazol-1-yl]-5-methylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole |
| SMILES | CCCCc1nn(-c2cc(C)cc(Oc3ccc4c5ccccc5n(-c5cc(C)ccn5)c4c3)c2)c(CCCC)c1C1C(C)=C[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C45H52N4O/c1-8-10-15-39-45(44-32(6)22-30(4)23-33(44)7)41(16-11-9-2)49(47-39)34-24-31(5)25-36(27-34)50-35-18-19-38-37-14-12-13-17-40(37)48(42(38)28-35)43-26-29(3)20-21-46-43/h12-14,17-22,24-28,30,33,44H,8-11,15-16,23H2,1-7H3/t30-,33-,44?/m0/s1 |
| InChIKey | DQNLSXNMUPGFBR-ORDDQGEJSA-N |
| XLogP | 12.16 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.94 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|