C47H50N4O2Pt — CID 153417389
2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methoxy-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153417389) has the molecular formula C47H50N4O2Pt and a molecular weight of 898.02 g/mol. Its IUPAC name is 2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methoxy-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methoxy-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153417389 |
| Molecular Formula | C47H50N4O2Pt |
| Molecular Weight | 898.02 g/mol |
| Exact Mass | 897.36 |
| IUPAC Name | 2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methoxy-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | COc1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5nc(C)c(C6C(C7CCCCC7)=CCC[C@@H]6C6CCCCC6)c5C)ccc4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C47H50N4O2.Pt/c1-31-46(47-39(33-14-6-4-7-15-33)21-13-22-40(47)34-16-8-5-9-17-34)32(2)51(49-31)35-18-12-19-37(28-35)53-38-24-25-42-41-20-10-11-23-43(41)50(44(42)29-38)45-30-36(52-3)26-27-48-45;/h10-12,18-21,23-27,30,33-34,40,47H,4-9,13-17,22H2,1-3H3;/q-2;+2/t40-,47?;/m1./s1 |
| InChIKey | HUQJXQPHHWUAKI-PVFSZNDNSA-N |
| XLogP | 11.96 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.02 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|