C50H58N4O — CID 153417940
2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-5-propan-2-ylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole (PubChem CID 153417940) has the molecular formula C50H58N4O and a molecular weight of 731.04 g/mol. Its IUPAC name is 2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-5-propan-2-ylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-5-propan-2-ylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153417940 |
| Molecular Formula | C50H58N4O |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.46 |
| IUPAC Name | 2-[3-[4-[(6R)-2,6-dicyclohexylcyclohex-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]-5-propan-2-ylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole |
| SMILES | Cc1ccnc(-n2c3ccccc3c3ccc(Oc4cc(C(C)C)cc(-n5nc(C)c(C6C(C7CCCCC7)=CCC[C@@H]6C6CCCCC6)c5C)c4)cc32)c1 |
| InChI | InChI=1S/C50H58N4O/c1-32(2)38-28-39(30-41(29-38)55-40-23-24-45-44-19-12-13-22-46(44)53(47(45)31-40)48-27-33(3)25-26-51-48)54-35(5)49(34(4)52-54)50-42(36-15-8-6-9-16-36)20-14-21-43(50)37-17-10-7-11-18-37/h12-13,19-20,22-32,36-37,43,50H,6-11,14-18,21H2,1-5H3/t43-,50?/m1/s1 |
| InChIKey | IEXSKZFHFVRYFM-XCZQRYNRSA-N |
| XLogP | 13.79 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|