C28H18N4Pt — CID 153419309
10H-benzo[h]quinolin-10-ide;4-phenylimidazo[1,2-a]benzimidazole;platinum(2+) (PubChem CID 153419309) has the molecular formula C28H18N4Pt and a molecular weight of 605.56 g/mol. Its IUPAC name is 10H-benzo[h]quinolin-10-ide;4-phenylimidazo[1,2-a]benzimidazole;platinum(2+).
| Compound Name | 10H-benzo[h]quinolin-10-ide;4-phenylimidazo[1,2-a]benzimidazole;platinum(2+) |
|---|---|
| PubChem CID | 153419309 |
| Molecular Formula | C28H18N4Pt |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | 10H-benzo[h]quinolin-10-ide;4-phenylimidazo[1,2-a]benzimidazole;platinum(2+) |
| SMILES | [Pt+2].[c-]1cccc2ccc3cccnc3c12.[c-]1ccccc1-n1c2ccccc2n2ccnc12 |
| InChI | InChI=1S/C15H10N3.C13H8N.Pt/c1-2-6-12(7-3-1)18-14-9-5-4-8-13(14)17-11-10-16-15(17)18;1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;/h1-6,8-11H;1-5,7-9H;/q2*-1;+2 |
| InChIKey | DIMOSBBWOPHJRO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|