About silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid
silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid (PubChem CID 155643179) has the molecular formula C20H13AgFNO2
and a molecular weight of 426.20 g/mol. Its IUPAC name is silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid.
Molecular Properties
| Compound Name | silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid |
| PubChem CID | 155643179 |
| Molecular Formula | C20H13AgFNO2 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccccc1F.[Ag+].[c-]1cccc2ccc3cccnc3c12 |
| InChI | InChI=1S/C13H8N.C7H5FO2.Ag/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;8-6-4-2-1-3-5(6)7(9)10;/h1-5,7-9H;1-4H,(H,9,10);/q-1;;+1 |
| InChIKey | GBGIEEDSUCGCED-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
The IUPAC name of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid (CID 155643179) is silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid.
What is the SMILES notation for silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
The canonical SMILES for silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid is O=C(O)c1ccccc1F.[Ag+].[c-]1cccc2ccc3cccnc3c12.
What is the InChIKey of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
The InChIKey is GBGIEEDSUCGCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N.C7H5FO2.Ag/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;8-6-4-2-1-3-5(6)7(9)10;/h1-5,7-9H;1-4H,(H,9,10);/q-1;;+1.
What are the key properties of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid has a molecular weight of 426.20 g/mol, XLogP of 4.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid is sourced from PubChem (CID 155643179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).