silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid

C20H13AgFNO2 — CID 155643179

IUPACsilver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid
SMILESO=C(O)c1ccccc1F.[Ag+].[c-]1cccc2ccc3cccnc3c12
InChIInChI=1S/C13H8N.C7H5FO2.Ag/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;8-6-4-2-1-3-5(6)7(9)10;/h1-5,7-9H;1-4H,(H,9,10);/q-1;;+1
InChIKeyGBGIEEDSUCGCED-UHFFFAOYSA-N
MW426.20 g/mol
LogP4.71
Rot. Bonds1

About silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid

silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid (PubChem CID 155643179) has the molecular formula C20H13AgFNO2 and a molecular weight of 426.20 g/mol. Its IUPAC name is silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid.

Molecular Properties

Compound Namesilver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid
PubChem CID155643179
Molecular FormulaC20H13AgFNO2
Molecular Weight426.20 g/mol
Exact Mass425.00
IUPAC Namesilver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid
SMILESO=C(O)c1ccccc1F.[Ag+].[c-]1cccc2ccc3cccnc3c12
InChIInChI=1S/C13H8N.C7H5FO2.Ag/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;8-6-4-2-1-3-5(6)7(9)10;/h1-5,7-9H;1-4H,(H,9,10);/q-1;;+1
InChIKeyGBGIEEDSUCGCED-UHFFFAOYSA-N
XLogP4.71
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500426.20
LogP ≤ 54.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
The IUPAC name of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid (CID 155643179) is silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid.
What is the SMILES notation for silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
The canonical SMILES for silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid is O=C(O)c1ccccc1F.[Ag+].[c-]1cccc2ccc3cccnc3c12.
What is the InChIKey of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
The InChIKey is GBGIEEDSUCGCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N.C7H5FO2.Ag/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;8-6-4-2-1-3-5(6)7(9)10;/h1-5,7-9H;1-4H,(H,9,10);/q-1;;+1.
What are the key properties of silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid?
silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid has a molecular weight of 426.20 g/mol, XLogP of 4.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver;10H-benzo[h]quinolin-10-ide;2-fluorobenzoic acid is sourced from PubChem (CID 155643179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).