C54H33F12InN6O3 — CID 153419634
tris[2-[(Z)-pyrrol-2-ylidene-(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenyl)methyl]pyrrol-1-yl]indigane (PubChem CID 153419634) has the molecular formula C54H33F12InN6O3 and a molecular weight of 1156.69 g/mol. Its IUPAC name is tris[2-[(Z)-pyrrol-2-ylidene-(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenyl)methyl]pyrrol-1-yl]indigane.
| Compound Name | tris[2-[(Z)-pyrrol-2-ylidene-(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenyl)methyl]pyrrol-1-yl]indigane |
|---|---|
| PubChem CID | 153419634 |
| Molecular Formula | C54H33F12InN6O3 |
| Molecular Weight | 1156.69 g/mol |
| Exact Mass | 1156.15 |
| IUPAC Name | tris[2-[(Z)-pyrrol-2-ylidene-(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenyl)methyl]pyrrol-1-yl]indigane |
| SMILES | C=CCOc1c(F)c(F)c(/C(=C2\C=CC=N2)c2cccn2[In](n2cccc2/C(=C2/C=CC=N2)c2c(F)c(F)c(OCC=C)c(F)c2F)n2cccc2/C(=C2/C=CC=N2)c2c(F)c(F)c(OCC=C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/3C18H11F4N2O.In/c3*1-2-9-25-18-16(21)14(19)13(15(20)17(18)22)12(10-5-3-7-23-10)11-6-4-8-24-11;/h3*2-8H,1,9H2;/q3*-1;+3/b3*12-10+; |
| InChIKey | XZAOIENTPFNWFQ-KDDVYIQXSA-N |
| XLogP | 12.58 |
| TPSA | 79.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1156.69 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|