C23H38N4O3 — CID 153420432
[4-(1,2,3,4,4a,5,6,7,8,8a-decahydro-1,5-naphthyridin-3-yl)cyclohexyl]-[4-(oxetane-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 153420432) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is [4-(1,2,3,4,4a,5,6,7,8,8a-decahydro-1,5-naphthyridin-3-yl)cyclohexyl]-[4-(oxetane-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(1,2,3,4,4a,5,6,7,8,8a-decahydro-1,5-naphthyridin-3-yl)cyclohexyl]-[4-(oxetane-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420432 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | [4-(1,2,3,4,4a,5,6,7,8,8a-decahydro-1,5-naphthyridin-3-yl)cyclohexyl]-[4-(oxetane-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCC(C2CNC3CCCNC3C2)CC1)N1CCN(C(=O)C2CCO2)CC1 |
| InChI | InChI=1S/C23H38N4O3/c28-22(26-9-11-27(12-10-26)23(29)21-7-13-30-21)17-5-3-16(4-6-17)18-14-20-19(25-15-18)2-1-8-24-20/h16-21,24-25H,1-15H2 |
| InChIKey | KYUBYFADUOGMKL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |