C28H17N3PtS — CID 153421152
2-[3-[(6-deuterio-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153421152) has the molecular formula C28H17N3PtS and a molecular weight of 623.62 g/mol. Its IUPAC name is 2-[3-[(6-deuterio-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-[(6-deuterio-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153421152 |
| Molecular Formula | C28H17N3PtS |
| Molecular Weight | 623.62 g/mol |
| Exact Mass | 623.09 |
| IUPAC Name | 2-[3-[(6-deuterio-2-pyridinyl)sulfanyl]benzene-2-id-1-yl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) |
| SMILES | [2H]c1cccc(Sc2[c-]c(-c3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)ccc2)n1.[Pt+2] |
| InChI | InChI=1S/C28H17N3S.Pt/c1-2-11-25-23(10-1)24-15-14-21(19-26(24)31(25)27-12-3-5-16-29-27)20-8-7-9-22(18-20)32-28-13-4-6-17-30-28;/h1-17H;/q-2;+2/i17D; |
| InChIKey | AFUDVCQDHRLITB-QHUFLJKCSA-N |
| XLogP | 6.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.62 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|