C36H35N3O — CID 153421247
6-tert-butyl-9-(5-tert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole (PubChem CID 153421247) has the molecular formula C36H35N3O and a molecular weight of 525.70 g/mol. Its IUPAC name is 6-tert-butyl-9-(5-tert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole.
| Compound Name | 6-tert-butyl-9-(5-tert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole |
|---|---|
| PubChem CID | 153421247 |
| Molecular Formula | C36H35N3O |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 6-tert-butyl-9-(5-tert-butyl-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole |
| SMILES | CC(C)(C)c1ccc(-n2c3ccc(C(C)(C)C)cc3c3ccc(-c4cccc(Oc5ccccn5)c4)cc32)nc1 |
| InChI | InChI=1S/C36H35N3O/c1-35(2,3)26-14-17-31-30(22-26)29-16-13-25(24-10-9-11-28(20-24)40-34-12-7-8-19-37-34)21-32(29)39(31)33-18-15-27(23-38-33)36(4,5)6/h7-23H,1-6H3 |
| InChIKey | LNDBSVNOWZJUJW-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |