C28H19N3O — CID 153421326
9-(3,4-dideuterio-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole (PubChem CID 153421326) has the molecular formula C28H19N3O and a molecular weight of 415.49 g/mol. Its IUPAC name is 9-(3,4-dideuterio-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole.
| Compound Name | 9-(3,4-dideuterio-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole |
|---|---|
| PubChem CID | 153421326 |
| Molecular Formula | C28H19N3O |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 9-(3,4-dideuterio-2-pyridinyl)-2-(3-pyridin-2-yloxyphenyl)carbazole |
| SMILES | [2H]c1ccnc(-n2c3ccccc3c3ccc(-c4cccc(Oc5ccccn5)c4)cc32)c1[2H] |
| InChI | InChI=1S/C28H19N3O/c1-2-11-25-23(10-1)24-15-14-21(19-26(24)31(25)27-12-3-5-16-29-27)20-8-7-9-22(18-20)32-28-13-4-6-17-30-28/h1-19H/i3D,12D |
| InChIKey | QJIVRCAHJAEURM-YJMASPMESA-N |
| XLogP | 7.03 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |