C31H26N3O2P — CID 153421803
N,N-dimethyl-2-[3-[5-(4-methyl-2-pyridinyl)-5-oxobenzo[b]phosphindol-3-yl]phenoxy]pyridin-4-amine (PubChem CID 153421803) has the molecular formula C31H26N3O2P and a molecular weight of 503.54 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-[5-(4-methyl-2-pyridinyl)-5-oxobenzo[b]phosphindol-3-yl]phenoxy]pyridin-4-amine.
| Compound Name | N,N-dimethyl-2-[3-[5-(4-methyl-2-pyridinyl)-5-oxobenzo[b]phosphindol-3-yl]phenoxy]pyridin-4-amine |
|---|---|
| PubChem CID | 153421803 |
| Molecular Formula | C31H26N3O2P |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N,N-dimethyl-2-[3-[5-(4-methyl-2-pyridinyl)-5-oxobenzo[b]phosphindol-3-yl]phenoxy]pyridin-4-amine |
| SMILES | Cc1ccnc(P2(=O)c3ccccc3-c3ccc(-c4cccc(Oc5cc(N(C)C)ccn5)c4)cc32)c1 |
| InChI | InChI=1S/C31H26N3O2P/c1-21-13-15-33-31(17-21)37(35)28-10-5-4-9-26(28)27-12-11-23(19-29(27)37)22-7-6-8-25(18-22)36-30-20-24(34(2)3)14-16-32-30/h4-20H,1-3H3 |
| InChIKey | ZPZGWUDHUDPFFA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|