C32H29BN4O — CID 153421588
2-[3-[3-[[4-(dimethylamino)-2-pyridinyl]oxy]phenyl]benzo[b][1]benzoborol-5-yl]-N,N-dimethylpyridin-4-amine (PubChem CID 153421588) has the molecular formula C32H29BN4O and a molecular weight of 496.42 g/mol. Its IUPAC name is 2-[3-[3-[[4-(dimethylamino)-2-pyridinyl]oxy]phenyl]benzo[b][1]benzoborol-5-yl]-N,N-dimethylpyridin-4-amine.
| Compound Name | 2-[3-[3-[[4-(dimethylamino)-2-pyridinyl]oxy]phenyl]benzo[b][1]benzoborol-5-yl]-N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 153421588 |
| Molecular Formula | C32H29BN4O |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 2-[3-[3-[[4-(dimethylamino)-2-pyridinyl]oxy]phenyl]benzo[b][1]benzoborol-5-yl]-N,N-dimethylpyridin-4-amine |
| SMILES | CN(C)c1ccnc(Oc2cccc(-c3ccc4c(c3)B(c3cc(N(C)C)ccn3)c3ccccc3-4)c2)c1 |
| InChI | InChI=1S/C32H29BN4O/c1-36(2)24-14-16-34-31(20-24)33-29-11-6-5-10-27(29)28-13-12-23(19-30(28)33)22-8-7-9-26(18-22)38-32-21-25(37(3)4)15-17-35-32/h5-21H,1-4H3 |
| InChIKey | AFJOFGFBMDVZPN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|