C29H50 — CID 153422877
(8S,9S,10R,13R,14S,17R)-17-[(2R)-5,5-dimethylhexan-2-yl]-3,3,10,13-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 153422877) has the molecular formula C29H50 and a molecular weight of 398.72 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-17-[(2R)-5,5-dimethylhexan-2-yl]-3,3,10,13-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13R,14S,17R)-17-[(2R)-5,5-dimethylhexan-2-yl]-3,3,10,13-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 153422877 |
| Molecular Formula | C29H50 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.39 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-17-[(2R)-5,5-dimethylhexan-2-yl]-3,3,10,13-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@H](CCC(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(C)(C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H50/c1-20(13-15-26(2,3)4)23-11-12-24-22-10-9-21-19-27(5,6)17-18-28(21,7)25(22)14-16-29(23,24)8/h9,20,22-25H,10-19H2,1-8H3/t20-,22+,23-,24+,25+,28+,29-/m1/s1 |
| InChIKey | VNPKFBDQIYGWCV-HIKQCKOOSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|