C20H14NO2+ — CID 153422921
9-(3-methoxyphenyl)-10-oxa-15-azoniatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,8,11,13-heptaene (PubChem CID 153422921) has the molecular formula C20H14NO2+ and a molecular weight of 300.34 g/mol. Its IUPAC name is 9-(3-methoxyphenyl)-10-oxa-15-azoniatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,8,11,13-heptaene.
| Compound Name | 9-(3-methoxyphenyl)-10-oxa-15-azoniatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,8,11,13-heptaene |
|---|---|
| PubChem CID | 153422921 |
| Molecular Formula | C20H14NO2+ |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 9-(3-methoxyphenyl)-10-oxa-15-azoniatetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2,4,6,8,11,13-heptaene |
| SMILES | COc1cccc(-c2oc3cccc4[n+]3c2-c2ccccc2-4)c1 |
| InChI | InChI=1S/C20H14NO2/c1-22-14-7-4-6-13(12-14)20-19-16-9-3-2-8-15(16)17-10-5-11-18(23-20)21(17)19/h2-12H,1H3/q+1 |
| InChIKey | WEYDQFGXBRMJGW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|