C18H17N5O3 — CID 153424324
[6-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate (PubChem CID 153424324) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is [6-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate.
| Compound Name | [6-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate |
|---|---|
| PubChem CID | 153424324 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [6-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylamino]imidazo[1,2-a]pyridin-5-yl] formate |
| SMILES | Cn1c(=O)n(C)c2cc(CNc3ccc4nccn4c3OC=O)ccc21 |
| InChI | InChI=1S/C18H17N5O3/c1-21-14-5-3-12(9-15(14)22(2)18(21)25)10-20-13-4-6-16-19-7-8-23(16)17(13)26-11-24/h3-9,11,20H,10H2,1-2H3 |
| InChIKey | INJJGIUMDJBLCX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|