C45H42NP3S3 — CID 153424520
8,14,22-triphenyl-5,11,17-tripropyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 153424520) has the molecular formula C45H42NP3S3 and a molecular weight of 785.96 g/mol. Its IUPAC name is 8,14,22-triphenyl-5,11,17-tripropyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,14,22-triphenyl-5,11,17-tripropyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 153424520 |
| Molecular Formula | C45H42NP3S3 |
| Molecular Weight | 785.96 g/mol |
| Exact Mass | 785.17 |
| IUPAC Name | 8,14,22-triphenyl-5,11,17-tripropyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CCCc1cc2c3c(c1)P(=S)(c1ccccc1)c1cc(CCC)cc4c1N3c1c(cc(CCC)cc1P4(=S)c1ccccc1)P2(=S)c1ccccc1 |
| InChI | InChI=1S/C45H42NP3S3/c1-4-16-31-25-37-43-38(26-31)48(51,35-21-12-8-13-22-35)40-28-33(18-6-3)30-42-45(40)46(43)44-39(47(37,50)34-19-10-7-11-20-34)27-32(17-5-2)29-41(44)49(42,52)36-23-14-9-15-24-36/h7-15,19-30H,4-6,16-18H2,1-3H3 |
| InChIKey | JXJCEGDZCVAWIC-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.96 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|