C28H47N — CID 153425161
N,N-bis[2-(1-adamantyl)ethyl]-2-methylpropan-2-amine (PubChem CID 153425161) has the molecular formula C28H47N and a molecular weight of 397.69 g/mol. Its IUPAC name is N,N-bis[2-(1-adamantyl)ethyl]-2-methylpropan-2-amine.
| Compound Name | N,N-bis[2-(1-adamantyl)ethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 153425161 |
| Molecular Formula | C28H47N |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.37 |
| IUPAC Name | N,N-bis[2-(1-adamantyl)ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N(CCC12CC3CC(CC(C3)C1)C2)CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H47N/c1-26(2,3)29(6-4-27-14-20-8-21(15-27)10-22(9-20)16-27)7-5-28-17-23-11-24(18-28)13-25(12-23)19-28/h20-25H,4-19H2,1-3H3 |
| InChIKey | PAJZZVADAZYWGT-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |