C16H30N2 — CID 113285775
N'-[2-(1-adamantyl)ethyl]-N'-methylpropane-1,3-diamine (PubChem CID 113285775) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)ethyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-[2-(1-adamantyl)ethyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 113285775 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N'-[2-(1-adamantyl)ethyl]-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H30N2/c1-18(5-2-4-17)6-3-16-10-13-7-14(11-16)9-15(8-13)12-16/h13-15H,2-12,17H2,1H3 |
| InChIKey | QQQFVVWRGZMPBL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |