C23H38N2 — CID 139912935
N',N'-bis(1-adamantyl)propane-1,3-diamine (PubChem CID 139912935) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is N',N'-bis(1-adamantyl)propane-1,3-diamine.
| Compound Name | N',N'-bis(1-adamantyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 139912935 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | N',N'-bis(1-adamantyl)propane-1,3-diamine |
| SMILES | NCCCN(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H38N2/c24-2-1-3-25(22-10-16-4-17(11-22)6-18(5-16)12-22)23-13-19-7-20(14-23)9-21(8-19)15-23/h16-21H,1-15,24H2 |
| InChIKey | UDKKTWQZJJIEAV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |