About N'-(1-adamantyl)propane-1,3-diamine
N'-(1-adamantyl)propane-1,3-diamine (PubChem CID 5032001) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-(1-adamantyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(1-adamantyl)propane-1,3-diamine |
| PubChem CID | 5032001 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N'-(1-adamantyl)propane-1,3-diamine |
| SMILES | NCCCNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H24N2/c14-2-1-3-15-13-7-10-4-11(8-13)6-12(5-10)9-13/h10-12,15H,1-9,14H2 |
| InChIKey | PEISMEIIGOUEOP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-adamantyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-adamantyl)propane-1,3-diamine?
The IUPAC name of N'-(1-adamantyl)propane-1,3-diamine (CID 5032001) is N'-(1-adamantyl)propane-1,3-diamine.
What is the SMILES notation for N'-(1-adamantyl)propane-1,3-diamine?
The canonical SMILES for N'-(1-adamantyl)propane-1,3-diamine is NCCCNC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N'-(1-adamantyl)propane-1,3-diamine?
The InChIKey is PEISMEIIGOUEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c14-2-1-3-15-13-7-10-4-11(8-13)6-12(5-10)9-13/h10-12,15H,1-9,14H2.
What are the key properties of N'-(1-adamantyl)propane-1,3-diamine?
N'-(1-adamantyl)propane-1,3-diamine has a molecular weight of 208.35 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-adamantyl)propane-1,3-diamine is sourced from PubChem (CID 5032001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).