C13H24N2 — CID 5032001
N'-(1-adamantyl)propane-1,3-diamine (PubChem CID 5032001) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-(1-adamantyl)propane-1,3-diamine.
| Compound Name | N'-(1-adamantyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 5032001 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N'-(1-adamantyl)propane-1,3-diamine |
| SMILES | NCCCNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H24N2/c14-2-1-3-15-13-7-10-4-11(8-13)6-12(5-10)9-13/h10-12,15H,1-9,14H2 |
| InChIKey | PEISMEIIGOUEOP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|