C17H31ClN2 — CID 165085924
N'-chloro-N'-[[(3S)-4-methyl-1-adamantyl]methyl]pentane-1,5-diamine (PubChem CID 165085924) has the molecular formula C17H31ClN2 and a molecular weight of 298.90 g/mol. Its IUPAC name is N'-chloro-N'-[[(3S)-4-methyl-1-adamantyl]methyl]pentane-1,5-diamine.
| Compound Name | N'-chloro-N'-[[(3S)-4-methyl-1-adamantyl]methyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 165085924 |
| Molecular Formula | C17H31ClN2 |
| Molecular Weight | 298.90 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N'-chloro-N'-[[(3S)-4-methyl-1-adamantyl]methyl]pentane-1,5-diamine |
| SMILES | CC1C2CC3C[C@H]1CC(CN(Cl)CCCCCN)(C3)C2 |
| InChI | InChI=1S/C17H31ClN2/c1-13-15-7-14-8-16(13)11-17(9-14,10-15)12-20(18)6-4-2-3-5-19/h13-16H,2-12,19H2,1H3/t13?,14?,15-,16?,17?/m0/s1 |
| InChIKey | VXDXZPSIWCZIFO-AYXGTZKJSA-N |
| XLogP | 4.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|