C8H17Cl3O4Si — CID 153425478
2,2-bis(2-methoxyethoxy)ethyl-trichlorosilane (PubChem CID 153425478) has the molecular formula C8H17Cl3O4Si and a molecular weight of 311.67 g/mol. Its IUPAC name is 2,2-bis(2-methoxyethoxy)ethyl-trichlorosilane.
| Compound Name | 2,2-bis(2-methoxyethoxy)ethyl-trichlorosilane |
|---|---|
| PubChem CID | 153425478 |
| Molecular Formula | C8H17Cl3O4Si |
| Molecular Weight | 311.67 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 2,2-bis(2-methoxyethoxy)ethyl-trichlorosilane |
| SMILES | COCCOC(C[Si](Cl)(Cl)Cl)OCCOC |
| InChI | InChI=1S/C8H17Cl3O4Si/c1-12-3-5-14-8(7-16(9,10)11)15-6-4-13-2/h8H,3-7H2,1-2H3 |
| InChIKey | YUYCXQAOKLTZJL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|