C8H20AlNaO5 — CID 173166942
sodium;1,2-bis(2-methoxyethoxy)ethoxyalumane;hydride (PubChem CID 173166942) has the molecular formula C8H20AlNaO5 and a molecular weight of 246.21 g/mol. Its IUPAC name is sodium;1,2-bis(2-methoxyethoxy)ethoxyalumane;hydride.
| Compound Name | sodium;1,2-bis(2-methoxyethoxy)ethoxyalumane;hydride |
|---|---|
| PubChem CID | 173166942 |
| Molecular Formula | C8H20AlNaO5 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | sodium;1,2-bis(2-methoxyethoxy)ethoxyalumane;hydride |
| SMILES | COCCOCC(O[AlH2])OCCOC.[H-].[Na+] |
| InChI | InChI=1S/C8H17O5.Al.Na.3H/c1-10-3-5-12-7-8(9)13-6-4-11-2;;;;;/h8H,3-7H2,1-2H3;;;;;/q-1;2*+1;;;-1 |
| InChIKey | MNQSOMVXPDSCSG-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|