About sodium;1,2-dimethoxyethoxyalumane;hydride
sodium;1,2-dimethoxyethoxyalumane;hydride (PubChem CID 173040262) has the molecular formula C4H12AlNaO3
and a molecular weight of 158.11 g/mol. Its IUPAC name is sodium;1,2-dimethoxyethoxyalumane;hydride.
Molecular Properties
| Compound Name | sodium;1,2-dimethoxyethoxyalumane;hydride |
| PubChem CID | 173040262 |
| Molecular Formula | C4H12AlNaO3 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | sodium;1,2-dimethoxyethoxyalumane;hydride |
| SMILES | COCC(OC)O[AlH2].[H-].[Na+] |
| InChI | InChI=1S/C4H9O3.Al.Na.3H/c1-6-3-4(5)7-2;;;;;/h4H,3H2,1-2H3;;;;;/q-1;2*+1;;;-1 |
| InChIKey | NCWMDMIZVULZLB-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze sodium;1,2-dimethoxyethoxyalumane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1,2-dimethoxyethoxyalumane;hydride?
The IUPAC name of sodium;1,2-dimethoxyethoxyalumane;hydride (CID 173040262) is sodium;1,2-dimethoxyethoxyalumane;hydride.
What is the SMILES notation for sodium;1,2-dimethoxyethoxyalumane;hydride?
The canonical SMILES for sodium;1,2-dimethoxyethoxyalumane;hydride is COCC(OC)O[AlH2].[H-].[Na+].
What is the InChIKey of sodium;1,2-dimethoxyethoxyalumane;hydride?
The InChIKey is NCWMDMIZVULZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O3.Al.Na.3H/c1-6-3-4(5)7-2;;;;;/h4H,3H2,1-2H3;;;;;/q-1;2*+1;;;-1.
What are the key properties of sodium;1,2-dimethoxyethoxyalumane;hydride?
sodium;1,2-dimethoxyethoxyalumane;hydride has a molecular weight of 158.11 g/mol, XLogP of -3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1,2-dimethoxyethoxyalumane;hydride is sourced from PubChem (CID 173040262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).