C4H12AlNaO3 — CID 173040262
sodium;1,2-dimethoxyethoxyalumane;hydride (PubChem CID 173040262) has the molecular formula C4H12AlNaO3 and a molecular weight of 158.11 g/mol. Its IUPAC name is sodium;1,2-dimethoxyethoxyalumane;hydride.
| Compound Name | sodium;1,2-dimethoxyethoxyalumane;hydride |
|---|---|
| PubChem CID | 173040262 |
| Molecular Formula | C4H12AlNaO3 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | sodium;1,2-dimethoxyethoxyalumane;hydride |
| SMILES | COCC(OC)O[AlH2].[H-].[Na+] |
| InChI | InChI=1S/C4H9O3.Al.Na.3H/c1-6-3-4(5)7-2;;;;;/h4H,3H2,1-2H3;;;;;/q-1;2*+1;;;-1 |
| InChIKey | NCWMDMIZVULZLB-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|